C26H29ClN6O5S — CID 59677085
ethyl 3-[(3R,4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]pyrrolidin-1-yl]-3-oxopropanoate (PubChem CID 59677085) has the molecular formula C26H29ClN6O5S and a molecular weight of 573.08 g/mol. Its IUPAC name is ethyl 3-[(3R,4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]pyrrolidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[(3R,4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]pyrrolidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 59677085 |
| Molecular Formula | C26H29ClN6O5S |
| Molecular Weight | 573.08 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | ethyl 3-[(3R,4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]pyrrolidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1C[C@@H](NC(=O)c2cc3cc(Cl)ccc3[nH]2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C26H29ClN6O5S/c1-3-38-23(35)10-22(34)33-11-19(29-24(36)18-9-14-8-15(27)4-5-16(14)28-18)20(12-33)30-25(37)26-31-17-6-7-32(2)13-21(17)39-26/h4-5,8-9,19-20,28H,3,6-7,10-13H2,1-2H3,(H,29,36)(H,30,37)/t19-,20-/m1/s1 |
| InChIKey | ZYNAONWHGDXYNP-WOJBJXKFSA-N |
| XLogP | 1.96 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.08 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|