C26H31ClN6O4S — CID 70376041
[(4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclopentyl]methyl N,N-dimethylcarbamate (PubChem CID 70376041) has the molecular formula C26H31ClN6O4S and a molecular weight of 559.09 g/mol. Its IUPAC name is [(4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclopentyl]methyl N,N-dimethylcarbamate.
| Compound Name | [(4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclopentyl]methyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 70376041 |
| Molecular Formula | C26H31ClN6O4S |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | [(4R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-4-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclopentyl]methyl N,N-dimethylcarbamate |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3CC(COC(=O)N(C)C)CC3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C26H31ClN6O4S/c1-32(2)26(36)37-13-14-8-19(29-23(34)21-11-15-10-16(27)4-5-17(15)28-21)20(9-14)30-24(35)25-31-18-6-7-33(3)12-22(18)38-25/h4-5,10-11,14,19-20,28H,6-9,12-13H2,1-3H3,(H,29,34)(H,30,35)/t14?,19?,20-/m1/s1 |
| InChIKey | IIPYDCJWVDUTRJ-OJISFJIHSA-N |
| XLogP | 3.27 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |