C24H30BClN2O4S — CID 59677317
[4-[13-chloro-9-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]-methylborinic acid (PubChem CID 59677317) has the molecular formula C24H30BClN2O4S and a molecular weight of 488.85 g/mol. Its IUPAC name is [4-[13-chloro-9-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[13-chloro-9-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59677317 |
| Molecular Formula | C24H30BClN2O4S |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [4-[13-chloro-9-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(C2c3ccc(Cl)cc3C=C(CCCOS(C)(=O)=O)c3cccnc32)CC1 |
| InChI | InChI=1S/C24H30BClN2O4S/c1-25(29)28-12-9-17(10-13-28)23-21-8-7-20(26)16-19(21)15-18(5-4-14-32-33(2,30)31)22-6-3-11-27-24(22)23/h3,6-8,11,15-17,23,29H,4-5,9-10,12-14H2,1-2H3 |
| InChIKey | IEYGECZMZUTVCG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|