C34H34N8O2 — CID 59677505
4-[(2S)-10-[acetamido-(3-methylimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]-N-(4-isocyanophenyl)piperazine-1-carboxamide (PubChem CID 59677505) has the molecular formula C34H34N8O2 and a molecular weight of 586.70 g/mol. Its IUPAC name is 4-[(2S)-10-[acetamido-(3-methylimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]-N-(4-isocyanophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(2S)-10-[acetamido-(3-methylimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]-N-(4-isocyanophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59677505 |
| Molecular Formula | C34H34N8O2 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 4-[(2S)-10-[acetamido-(3-methylimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]-N-(4-isocyanophenyl)piperazine-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)N2CCN([C@H]3c4ccc(C)cc4C(C(NC(C)=O)c4cncn4C)=Cc4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C34H34N8O2/c1-22-7-12-27-28(18-22)29(32(38-23(2)43)30-20-36-21-40(30)4)19-24-6-5-13-37-31(24)33(27)41-14-16-42(17-15-41)34(44)39-26-10-8-25(35-3)9-11-26/h5-13,18-21,32-33H,14-17H2,1-2,4H3,(H,38,43)(H,39,44)/t32?,33-/m0/s1 |
| InChIKey | FWWURIVEMHKBBP-OBOZPERJSA-N |
| XLogP | 5.34 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|