C26H39N3O5 — CID 59680828
benzyl (2S)-1-[(2S)-2-[[(4S)-4-amino-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate (PubChem CID 59680828) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-[[(4S)-4-amino-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-2-[[(4S)-4-amino-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59680828 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-[[(4S)-4-amino-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)C[C@H](NC(=O)C(C)C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H39N3O5/c1-16(2)14-20(28-24(31)18(5)23(30)22(27)17(3)4)25(32)29-13-9-12-21(29)26(33)34-15-19-10-7-6-8-11-19/h6-8,10-11,16-18,20-22H,9,12-15,27H2,1-5H3,(H,28,31)/t18?,20-,21-,22-/m0/s1 |
| InChIKey | ABRLUSXGNJUWMH-WDHNVLQZSA-N |
| XLogP | 2.44 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|