C27H40N2O5 — CID 59680886
benzyl (2S)-1-[(2S)-4-methyl-2-[[(2R,4S)-2,4,5-trimethyl-3-oxohexanoyl]amino]pentanoyl]pyrrolidine-2-carboxylate (PubChem CID 59680886) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-4-methyl-2-[[(2R,4S)-2,4,5-trimethyl-3-oxohexanoyl]amino]pentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-4-methyl-2-[[(2R,4S)-2,4,5-trimethyl-3-oxohexanoyl]amino]pentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59680886 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | benzyl (2S)-1-[(2S)-4-methyl-2-[[(2R,4S)-2,4,5-trimethyl-3-oxohexanoyl]amino]pentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)C(=O)[C@@H](C)C(C)C)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H40N2O5/c1-17(2)15-22(28-25(31)20(6)24(30)19(5)18(3)4)26(32)29-14-10-13-23(29)27(33)34-16-21-11-8-7-9-12-21/h7-9,11-12,17-20,22-23H,10,13-16H2,1-6H3,(H,28,31)/t19-,20+,22-,23-/m0/s1 |
| InChIKey | NYUOBOVKVAGLBA-MQFRRQCYSA-N |
| XLogP | 3.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|