C29H35ClFN5O — CID 59681414
3-(3-chloro-4-fluorophenyl)-1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-[4-(4-methylpiperazin-1-yl)butyl]urea (PubChem CID 59681414) has the molecular formula C29H35ClFN5O and a molecular weight of 524.08 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-[4-(4-methylpiperazin-1-yl)butyl]urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-[4-(4-methylpiperazin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 59681414 |
| Molecular Formula | C29H35ClFN5O |
| Molecular Weight | 524.08 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-[4-(4-methylpiperazin-1-yl)butyl]urea |
| SMILES | CN1CCN(CCCCN(C(=O)Nc2ccc(F)c(Cl)c2)[C@@H]2CC[C@]3(c4ccc(C#N)cc4)CC23)CC1 |
| InChI | InChI=1S/C29H35ClFN5O/c1-34-14-16-35(17-15-34)12-2-3-13-36(28(37)33-23-8-9-26(31)25(30)18-23)27-10-11-29(19-24(27)29)22-6-4-21(20-32)5-7-22/h4-9,18,24,27H,2-3,10-17,19H2,1H3,(H,33,37)/t24?,27-,29-/m1/s1 |
| InChIKey | QEKKRTDPGNTEKG-SCANVSGJSA-N |
| XLogP | 5.33 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.08 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|