C29H32F4N6O2S — CID 58619410
1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-3-[4-fluoro-2-nitro-5-(trifluoromethyl)phenyl]-1-[3-(4-methylpiperazin-1-yl)propyl]thiourea (PubChem CID 58619410) has the molecular formula C29H32F4N6O2S and a molecular weight of 604.67 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-3-[4-fluoro-2-nitro-5-(trifluoromethyl)phenyl]-1-[3-(4-methylpiperazin-1-yl)propyl]thiourea.
| Compound Name | 1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-3-[4-fluoro-2-nitro-5-(trifluoromethyl)phenyl]-1-[3-(4-methylpiperazin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 58619410 |
| Molecular Formula | C29H32F4N6O2S |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 1-[(2R,5S)-5-(4-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-3-[4-fluoro-2-nitro-5-(trifluoromethyl)phenyl]-1-[3-(4-methylpiperazin-1-yl)propyl]thiourea |
| SMILES | CN1CCN(CCCN(C(=S)Nc2cc(C(F)(F)F)c(F)cc2[N+](=O)[O-])[C@@H]2CC[C@]3(c4ccc(C#N)cc4)CC23)CC1 |
| InChI | InChI=1S/C29H32F4N6O2S/c1-36-11-13-37(14-12-36)9-2-10-38(25-7-8-28(17-22(25)28)20-5-3-19(18-34)4-6-20)27(42)35-24-15-21(29(31,32)33)23(30)16-26(24)39(40)41/h3-6,15-16,22,25H,2,7-14,17H2,1H3,(H,35,42)/t22?,25-,28-/m1/s1 |
| InChIKey | WLMWFAXLZHFTFH-JKRBJUMTSA-N |
| XLogP | 5.38 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|