C21H18F2N3O+ — CID 59682327
[(2S)-4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone (PubChem CID 59682327) has the molecular formula C21H18F2N3O+ and a molecular weight of 366.39 g/mol. Its IUPAC name is [(2S)-4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone.
| Compound Name | [(2S)-4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 59682327 |
| Molecular Formula | C21H18F2N3O+ |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [(2S)-4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone |
| SMILES | C[n+]1ccn(C(=O)N2CC(c3cc(F)ccc3F)=C[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C21H18F2N3O/c1-24-9-10-25(14-24)21(27)26-13-16(18-12-17(22)7-8-19(18)23)11-20(26)15-5-3-2-4-6-15/h2-12,14,20H,13H2,1H3/q+1/t20-/m0/s1 |
| InChIKey | LLKORXMSPCTWQG-FQEVSTJZSA-N |
| XLogP | 3.70 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|