About 9,9-dipropyl-1H-indeno[2,1-f]indole
9,9-dipropyl-1H-indeno[2,1-f]indole (PubChem CID 59685316) has the molecular formula C21H23N
and a molecular weight of 289.42 g/mol. Its IUPAC name is 9,9-dipropyl-1H-indeno[2,1-f]indole.
Molecular Properties
| Compound Name | 9,9-dipropyl-1H-indeno[2,1-f]indole |
| PubChem CID | 59685316 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 9,9-dipropyl-1H-indeno[2,1-f]indole |
| SMILES | CCCC1(CCC)c2ccccc2-c2cc3c(cc21)CC=N3 |
| InChI | InChI=1S/C21H23N/c1-3-10-21(11-4-2)18-8-6-5-7-16(18)17-14-20-15(9-12-22-20)13-19(17)21/h5-8,12-14H,3-4,9-11H2,1-2H3 |
| InChIKey | IVVCCWLKWZAYQI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9,9-dipropyl-1H-indeno[2,1-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dipropyl-1H-indeno[2,1-f]indole?
The IUPAC name of 9,9-dipropyl-1H-indeno[2,1-f]indole (CID 59685316) is 9,9-dipropyl-1H-indeno[2,1-f]indole.
What is the SMILES notation for 9,9-dipropyl-1H-indeno[2,1-f]indole?
The canonical SMILES for 9,9-dipropyl-1H-indeno[2,1-f]indole is CCCC1(CCC)c2ccccc2-c2cc3c(cc21)CC=N3.
What is the InChIKey of 9,9-dipropyl-1H-indeno[2,1-f]indole?
The InChIKey is IVVCCWLKWZAYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N/c1-3-10-21(11-4-2)18-8-6-5-7-16(18)17-14-20-15(9-12-22-20)13-19(17)21/h5-8,12-14H,3-4,9-11H2,1-2H3.
What are the key properties of 9,9-dipropyl-1H-indeno[2,1-f]indole?
9,9-dipropyl-1H-indeno[2,1-f]indole has a molecular weight of 289.42 g/mol, XLogP of 5.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dipropyl-1H-indeno[2,1-f]indole is sourced from PubChem (CID 59685316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).