C37H24N4O3 — CID 59685410
5-[(E)-3-[9-(4-carbazol-9-ylphenyl)carbazol-3-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 59685410) has the molecular formula C37H24N4O3 and a molecular weight of 572.62 g/mol. Its IUPAC name is 5-[(E)-3-[9-(4-carbazol-9-ylphenyl)carbazol-3-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-[9-(4-carbazol-9-ylphenyl)carbazol-3-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59685410 |
| Molecular Formula | C37H24N4O3 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 5-[(E)-3-[9-(4-carbazol-9-ylphenyl)carbazol-3-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=C/C=C/c2ccc3c(c2)c2ccccc2n3-c2ccc(-n3c4ccccc4c4ccccc43)cc2)C(=O)N1 |
| InChI | InChI=1S/C37H24N4O3/c42-35-29(36(43)39-37(44)38-35)12-7-8-23-16-21-34-30(22-23)28-11-3-6-15-33(28)41(34)25-19-17-24(18-20-25)40-31-13-4-1-9-26(31)27-10-2-5-14-32(27)40/h1-22H,(H2,38,39,42,43,44)/b8-7+ |
| InChIKey | OPFHANAUQATAFD-BQYQJAHWSA-N |
| XLogP | 7.19 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|