C17H21ClO — CID 59686907
2-benzyl-3-(chloromethoxy)tricyclo[3.3.1.03,7]nonane (PubChem CID 59686907) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is 2-benzyl-3-(chloromethoxy)tricyclo[3.3.1.03,7]nonane.
| Compound Name | 2-benzyl-3-(chloromethoxy)tricyclo[3.3.1.03,7]nonane |
|---|---|
| PubChem CID | 59686907 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-benzyl-3-(chloromethoxy)tricyclo[3.3.1.03,7]nonane |
| SMILES | ClCOC12CC3CC(CC1C3)C2Cc1ccccc1 |
| InChI | InChI=1S/C17H21ClO/c18-11-19-17-10-13-6-14(9-15(17)7-13)16(17)8-12-4-2-1-3-5-12/h1-5,13-16H,6-11H2 |
| InChIKey | PKEBNRDVQSCMBD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|