C37H53NO8 — CID 59687925
5-O-benzyl 1-O-tert-butyl 2-[10-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]decanoylamino]pentanedioate (PubChem CID 59687925) has the molecular formula C37H53NO8 and a molecular weight of 639.83 g/mol. Its IUPAC name is 5-O-benzyl 1-O-tert-butyl 2-[10-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]decanoylamino]pentanedioate.
| Compound Name | 5-O-benzyl 1-O-tert-butyl 2-[10-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]decanoylamino]pentanedioate |
|---|---|
| PubChem CID | 59687925 |
| Molecular Formula | C37H53NO8 |
| Molecular Weight | 639.83 g/mol |
| Exact Mass | 639.38 |
| IUPAC Name | 5-O-benzyl 1-O-tert-butyl 2-[10-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]decanoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)c1ccc(OCCCCCCCCCC(=O)NC(CCC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C37H53NO8/c1-36(2,3)45-34(41)29-20-22-30(23-21-29)43-26-16-11-9-7-8-10-15-19-32(39)38-31(35(42)46-37(4,5)6)24-25-33(40)44-27-28-17-13-12-14-18-28/h12-14,17-18,20-23,31H,7-11,15-16,19,24-27H2,1-6H3,(H,38,39) |
| InChIKey | NPWNLCXLHHKUIE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.83 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|