C10H24N4O2 — CID 59688139
(2S)-4-amino-N-[3-(ethylamino)-2-hydroxypropyl]-2-(methylamino)butanamide (PubChem CID 59688139) has the molecular formula C10H24N4O2 and a molecular weight of 232.33 g/mol. Its IUPAC name is (2S)-4-amino-N-[3-(ethylamino)-2-hydroxypropyl]-2-(methylamino)butanamide.
| Compound Name | (2S)-4-amino-N-[3-(ethylamino)-2-hydroxypropyl]-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 59688139 |
| Molecular Formula | C10H24N4O2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2S)-4-amino-N-[3-(ethylamino)-2-hydroxypropyl]-2-(methylamino)butanamide |
| SMILES | CCNCC(O)CNC(=O)[C@H](CCN)NC |
| InChI | InChI=1S/C10H24N4O2/c1-3-13-6-8(15)7-14-10(16)9(12-2)4-5-11/h8-9,12-13,15H,3-7,11H2,1-2H3,(H,14,16)/t8?,9-/m0/s1 |
| InChIKey | SDIWNJBBIMOJSO-GKAPJAKFSA-N |
| XLogP | -1.99 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |