C19H18ClFN2O — CID 59688410
1-(4-chlorophenyl)-2-(3-fluorophenyl)-2,7-diazaspiro[3.5]nonan-3-one (PubChem CID 59688410) has the molecular formula C19H18ClFN2O and a molecular weight of 344.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3-fluorophenyl)-2,7-diazaspiro[3.5]nonan-3-one.
| Compound Name | 1-(4-chlorophenyl)-2-(3-fluorophenyl)-2,7-diazaspiro[3.5]nonan-3-one |
|---|---|
| PubChem CID | 59688410 |
| Molecular Formula | C19H18ClFN2O |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3-fluorophenyl)-2,7-diazaspiro[3.5]nonan-3-one |
| SMILES | O=C1N(c2cccc(F)c2)C(c2ccc(Cl)cc2)C12CCNCC2 |
| InChI | InChI=1S/C19H18ClFN2O/c20-14-6-4-13(5-7-14)17-19(8-10-22-11-9-19)18(24)23(17)16-3-1-2-15(21)12-16/h1-7,12,17,22H,8-11H2 |
| InChIKey | RTQNQRQRMOZWFJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |