C20H17ClFN3O — CID 59686034
2-(3-chloro-4-fluorophenyl)-1-(4-isocyanophenyl)-2,7-diazaspiro[3.5]nonan-3-one (PubChem CID 59686034) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(4-isocyanophenyl)-2,7-diazaspiro[3.5]nonan-3-one.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(4-isocyanophenyl)-2,7-diazaspiro[3.5]nonan-3-one |
|---|---|
| PubChem CID | 59686034 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(4-isocyanophenyl)-2,7-diazaspiro[3.5]nonan-3-one |
| SMILES | [C-]#[N+]c1ccc(C2N(c3ccc(F)c(Cl)c3)C(=O)C23CCNCC3)cc1 |
| InChI | InChI=1S/C20H17ClFN3O/c1-23-14-4-2-13(3-5-14)18-20(8-10-24-11-9-20)19(26)25(18)15-6-7-17(22)16(21)12-15/h2-7,12,18,24H,8-11H2 |
| InChIKey | SYLGZWAMJSECKP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|