C25H22ClF2N4O3+ — CID 59688463
2-(3-chlorophenyl)-N-(3,5-difluorophenyl)-1-(1-hydroxypyridin-1-ium-2-yl)-3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxamide (PubChem CID 59688463) has the molecular formula C25H22ClF2N4O3+ and a molecular weight of 499.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(3,5-difluorophenyl)-1-(1-hydroxypyridin-1-ium-2-yl)-3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-(3,5-difluorophenyl)-1-(1-hydroxypyridin-1-ium-2-yl)-3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxamide |
|---|---|
| PubChem CID | 59688463 |
| Molecular Formula | C25H22ClF2N4O3+ |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(3,5-difluorophenyl)-1-(1-hydroxypyridin-1-ium-2-yl)-3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)N1CCC2(CC1)C(=O)N(c1cccc(Cl)c1)C2c1cccc[n+]1O |
| InChI | InChI=1S/C25H21ClF2N4O3/c26-16-4-3-5-20(12-16)32-22(21-6-1-2-9-31(21)35)25(23(32)33)7-10-30(11-8-25)24(34)29-19-14-17(27)13-18(28)15-19/h1-6,9,12-15,22H,7-8,10-11H2,(H-,29,34,35)/p+1 |
| InChIKey | IBILLBBFGLZZHG-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|