C23H20ClFN2O2 — CID 59689109
N-[2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl]-4-fluoro-3-methylbenzamide (PubChem CID 59689109) has the molecular formula C23H20ClFN2O2 and a molecular weight of 410.88 g/mol. Its IUPAC name is N-[2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl]-4-fluoro-3-methylbenzamide.
| Compound Name | N-[2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl]-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 59689109 |
| Molecular Formula | C23H20ClFN2O2 |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl]-4-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC(=O)NC(c2ccccc2)c2ccc(Cl)cc2)ccc1F |
| InChI | InChI=1S/C23H20ClFN2O2/c1-15-13-18(9-12-20(15)25)23(29)26-14-21(28)27-22(16-5-3-2-4-6-16)17-7-10-19(24)11-8-17/h2-13,22H,14H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | YRPBKPXXCQLBLT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |