C22H18Cl2N2O2 — CID 59689121
N-[2-[[(2,4-dichlorophenyl)-phenylmethyl]amino]-2-oxoethyl]benzamide (PubChem CID 59689121) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is N-[2-[[(2,4-dichlorophenyl)-phenylmethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[(2,4-dichlorophenyl)-phenylmethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59689121 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[2-[[(2,4-dichlorophenyl)-phenylmethyl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NC(c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O2/c23-17-11-12-18(19(24)13-17)21(15-7-3-1-4-8-15)26-20(27)14-25-22(28)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,25,28)(H,26,27) |
| InChIKey | KXXJLCZSCKQVBO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |