C25H23F3N2O2 — CID 59689158
N-[2-oxo-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-3-phenylpropanamide (PubChem CID 59689158) has the molecular formula C25H23F3N2O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[2-oxo-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-oxo-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 59689158 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[2-oxo-2-[[phenyl-[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCC(=O)NC(c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3N2O2/c26-25(27,28)21-14-12-20(13-15-21)24(19-9-5-2-6-10-19)30-23(32)17-29-22(31)16-11-18-7-3-1-4-8-18/h1-10,12-15,24H,11,16-17H2,(H,29,31)(H,30,32) |
| InChIKey | ONMSIBZEONPMIX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |