C25H28N2O — CID 60592502
3-(4-tert-butylphenyl)-N-[phenyl(pyridin-4-yl)methyl]propanamide (PubChem CID 60592502) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[phenyl(pyridin-4-yl)methyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[phenyl(pyridin-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 60592502 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[phenyl(pyridin-4-yl)methyl]propanamide |
| SMILES | CC(C)(C)c1ccc(CCC(=O)NC(c2ccccc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C25H28N2O/c1-25(2,3)22-12-9-19(10-13-22)11-14-23(28)27-24(20-7-5-4-6-8-20)21-15-17-26-18-16-21/h4-10,12-13,15-18,24H,11,14H2,1-3H3,(H,27,28) |
| InChIKey | OYSNMMFNKJUBHJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |