C23H20N2O4S2 — CID 59691901
N-[3-[3-amino-2-(3-methoxybenzoyl)-1-benzothiophen-6-yl]phenyl]methanesulfonamide (PubChem CID 59691901) has the molecular formula C23H20N2O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[3-[3-amino-2-(3-methoxybenzoyl)-1-benzothiophen-6-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[3-amino-2-(3-methoxybenzoyl)-1-benzothiophen-6-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59691901 |
| Molecular Formula | C23H20N2O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[3-[3-amino-2-(3-methoxybenzoyl)-1-benzothiophen-6-yl]phenyl]methanesulfonamide |
| SMILES | COc1cccc(C(=O)c2sc3cc(-c4cccc(NS(C)(=O)=O)c4)ccc3c2N)c1 |
| InChI | InChI=1S/C23H20N2O4S2/c1-29-18-8-4-6-16(12-18)22(26)23-21(24)19-10-9-15(13-20(19)30-23)14-5-3-7-17(11-14)25-31(2,27)28/h3-13,25H,24H2,1-2H3 |
| InChIKey | OGRQWPAUXFBGAH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |