C7H7N3S — CID 59693976
2-imidazol-1-yl-5-methyl-1,3-thiazole (PubChem CID 59693976) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 2-imidazol-1-yl-5-methyl-1,3-thiazole.
| Compound Name | 2-imidazol-1-yl-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 59693976 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-imidazol-1-yl-5-methyl-1,3-thiazole |
| SMILES | Cc1cnc(-n2ccnc2)s1 |
| InChI | InChI=1S/C7H7N3S/c1-6-4-9-7(11-6)10-3-2-8-5-10/h2-5H,1H3 |
| InChIKey | GQPNYKZGIQRKLS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |