About 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid
9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid (PubChem CID 59696652) has the molecular formula C11H8N4O3
and a molecular weight of 244.21 g/mol. Its IUPAC name is 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid |
| PubChem CID | 59696652 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid |
| SMILES | COc1cccc2cc(C(=O)O)c3nnnn3c12 |
| InChI | InChI=1S/C11H8N4O3/c1-18-8-4-2-3-6-5-7(11(16)17)10-12-13-14-15(10)9(6)8/h2-5H,1H3,(H,16,17) |
| InChIKey | LEBIHZRZVKWPJT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid?
The IUPAC name of 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid (CID 59696652) is 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid.
What is the SMILES notation for 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid?
The canonical SMILES for 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid is COc1cccc2cc(C(=O)O)c3nnnn3c12.
What is the InChIKey of 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid?
The InChIKey is LEBIHZRZVKWPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O3/c1-18-8-4-2-3-6-5-7(11(16)17)10-12-13-14-15(10)9(6)8/h2-5H,1H3,(H,16,17).
What are the key properties of 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid?
9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid has a molecular weight of 244.21 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxytetrazolo[1,5-a]quinoline-4-carboxylic acid is sourced from PubChem (CID 59696652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).