C22H27N2O4- — CID 59700573
3-[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoate (PubChem CID 59700573) has the molecular formula C22H27N2O4- and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoate.
| Compound Name | 3-[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 59700573 |
| Molecular Formula | C22H27N2O4- |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoate |
| SMILES | CCOC(Cc1ccc(NCCCN2CCOc3ccccc32)cc1)C(=O)[O-] |
| InChI | InChI=1S/C22H28N2O4/c1-2-27-21(22(25)26)16-17-8-10-18(11-9-17)23-12-5-13-24-14-15-28-20-7-4-3-6-19(20)24/h3-4,6-11,21,23H,2,5,12-16H2,1H3,(H,25,26)/p-1 |
| InChIKey | USOQPARFHFSEKW-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|