C40H37IrN3O-2 — CID 59702653
iridium;5-[2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]-5-pyridin-2-ylpentyl]-2-phenylpyridine;phenol (PubChem CID 59702653) has the molecular formula C40H37IrN3O-2 and a molecular weight of 767.97 g/mol. Its IUPAC name is iridium;5-[2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]-5-pyridin-2-ylpentyl]-2-phenylpyridine;phenol.
| Compound Name | iridium;5-[2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]-5-pyridin-2-ylpentyl]-2-phenylpyridine;phenol |
|---|---|
| PubChem CID | 59702653 |
| Molecular Formula | C40H37IrN3O-2 |
| Molecular Weight | 767.97 g/mol |
| Exact Mass | 768.26 |
| IUPAC Name | iridium;5-[2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]-5-pyridin-2-ylpentyl]-2-phenylpyridine;phenol |
| SMILES | CC(CCCc1ccccn1)(Cc1ccc(-c2[c-]cccc2)nc1)Cc1ccc(-c2[c-]cccc2)nc1.Oc1ccccc1.[Ir] |
| InChI | InChI=1S/C34H31N3.C6H6O.Ir/c1-34(21-10-16-31-15-8-9-22-35-31,23-27-17-19-32(36-25-27)29-11-4-2-5-12-29)24-28-18-20-33(37-26-28)30-13-6-3-7-14-30;7-6-4-2-1-3-5-6;/h2-9,11,13,15,17-20,22,25-26H,10,16,21,23-24H2,1H3;1-5,7H;/q-2;; |
| InChIKey | QNYLNHBTTJHTBF-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.97 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|