C34H32Cl4N2S2 — CID 597030
4-[[2,6-bis(4-chlorophenyl)piperidin-4-yl]disulfanyl]-2,6-bis(4-chlorophenyl)piperidine (PubChem CID 597030) has the molecular formula C34H32Cl4N2S2 and a molecular weight of 674.59 g/mol. Its IUPAC name is 4-[[2,6-bis(4-chlorophenyl)piperidin-4-yl]disulfanyl]-2,6-bis(4-chlorophenyl)piperidine.
| Compound Name | 4-[[2,6-bis(4-chlorophenyl)piperidin-4-yl]disulfanyl]-2,6-bis(4-chlorophenyl)piperidine |
|---|---|
| PubChem CID | 597030 |
| Molecular Formula | C34H32Cl4N2S2 |
| Molecular Weight | 674.59 g/mol |
| Exact Mass | 672.08 |
| IUPAC Name | 4-[[2,6-bis(4-chlorophenyl)piperidin-4-yl]disulfanyl]-2,6-bis(4-chlorophenyl)piperidine |
| SMILES | Clc1ccc(C2CC(SSC3CC(c4ccc(Cl)cc4)NC(c4ccc(Cl)cc4)C3)CC(c3ccc(Cl)cc3)N2)cc1 |
| InChI | InChI=1S/C34H32Cl4N2S2/c35-25-9-1-21(2-10-25)31-17-29(18-32(39-31)22-3-11-26(36)12-4-22)41-42-30-19-33(23-5-13-27(37)14-6-23)40-34(20-30)24-7-15-28(38)16-8-24/h1-16,29-34,39-40H,17-20H2 |
| InChIKey | UOWALNDCFHMJKK-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.59 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|