C25H29N5O4 — CID 59703412
methyl 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzoate (PubChem CID 59703412) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is methyl 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzoate.
| Compound Name | methyl 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzoate |
|---|---|
| PubChem CID | 59703412 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | methyl 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)c1 |
| InChI | InChI=1S/C25H29N5O4/c1-16-14-33-11-9-29(16)23-20-7-8-21(18-5-4-6-19(13-18)24(31)32-3)26-22(20)27-25(28-23)30-10-12-34-15-17(30)2/h4-8,13,16-17H,9-12,14-15H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | BKQIPNIYJKPTPT-IRXDYDNUSA-N |
| XLogP | 2.93 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |