C23H25N3O5 — CID 59706613
N-[2-[4-[[(2S)-oxiran-2-yl]methoxy]phenyl]ethyl]-2-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]acetamide (PubChem CID 59706613) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[2-[4-[[(2S)-oxiran-2-yl]methoxy]phenyl]ethyl]-2-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]acetamide.
| Compound Name | N-[2-[4-[[(2S)-oxiran-2-yl]methoxy]phenyl]ethyl]-2-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 59706613 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[2-[4-[[(2S)-oxiran-2-yl]methoxy]phenyl]ethyl]-2-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C2=NNC(=O)CC2)cc1)NCCc1ccc(OC[C@@H]2CO2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c27-22-10-9-21(25-26-22)17-3-7-19(8-4-17)31-15-23(28)24-12-11-16-1-5-18(6-2-16)29-13-20-14-30-20/h1-8,20H,9-15H2,(H,24,28)(H,26,27)/t20-/m1/s1 |
| InChIKey | DAKWHDHDCHZDFV-HXUWFJFHSA-N |
| XLogP | 1.82 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|