C8H7N3WY-2 — CID 59708835
1,4-dimethyl-3,6-dihydropyrazolo[4,5-c]pyridine-3,6-diide;tungsten;yttrium (PubChem CID 59708835) has the molecular formula C8H7N3WY-2 and a molecular weight of 417.91 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-dihydropyrazolo[4,5-c]pyridine-3,6-diide;tungsten;yttrium.
| Compound Name | 1,4-dimethyl-3,6-dihydropyrazolo[4,5-c]pyridine-3,6-diide;tungsten;yttrium |
|---|---|
| PubChem CID | 59708835 |
| Molecular Formula | C8H7N3WY-2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | 1,4-dimethyl-3,6-dihydropyrazolo[4,5-c]pyridine-3,6-diide;tungsten;yttrium |
| SMILES | Cc1n[c-]cc2c1[c-]nn2C.[W].[Y] |
| InChI | InChI=1S/C8H7N3.W.Y/c1-6-7-5-10-11(2)8(7)3-4-9-6;;/h3H,1-2H3;;/q-2;; |
| InChIKey | COSUSSDGEKMKOS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|