About 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten
1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten (PubChem CID 157282846) has the molecular formula C9H14N2W2
and a molecular weight of 517.91 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten.
Analyze 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten?
The IUPAC name of 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten (CID 157282846) is 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten.
What is the SMILES notation for 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten?
The canonical SMILES for 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten is C=C1C(C)=C(C)C(C)=NN1C.[W].[W].
What is the InChIKey of 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten?
The InChIKey is AZWGDVQXARCMKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.2W/c1-6-7(2)9(4)11(5)10-8(6)3;;/h4H2,1-3,5H3;;.
What are the key properties of 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten?
1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten has a molecular weight of 517.91 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4,5-tetramethyl-6-methylidenepyridazine;tungsten is sourced from PubChem (CID 157282846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).