C22H22FIN6O3 — CID 59708864
1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol (PubChem CID 59708864) has the molecular formula C22H22FIN6O3 and a molecular weight of 564.36 g/mol. Its IUPAC name is 1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol.
| Compound Name | 1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol |
|---|---|
| PubChem CID | 59708864 |
| Molecular Formula | C22H22FIN6O3 |
| Molecular Weight | 564.36 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CC#CCN1CCC(O)CC1 |
| InChI | InChI=1S/C22H22FIN6O3/c23-22-27-20(25)19-21(28-22)30(6-2-1-5-29-7-3-14(31)4-8-29)18(26-19)10-13-9-16-17(11-15(13)24)33-12-32-16/h9,11,14,31H,3-8,10,12H2,(H2,25,27,28) |
| InChIKey | FAJRIQWRVSRRHR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|