C18H19NO3 — CID 59709122
4-(1,3-dicyclopropyl-1,3-dioxopropan-2-yl)oxy-2,6-dimethylbenzonitrile (PubChem CID 59709122) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-(1,3-dicyclopropyl-1,3-dioxopropan-2-yl)oxy-2,6-dimethylbenzonitrile.
| Compound Name | 4-(1,3-dicyclopropyl-1,3-dioxopropan-2-yl)oxy-2,6-dimethylbenzonitrile |
|---|---|
| PubChem CID | 59709122 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-(1,3-dicyclopropyl-1,3-dioxopropan-2-yl)oxy-2,6-dimethylbenzonitrile |
| SMILES | Cc1cc(OC(C(=O)C2CC2)C(=O)C2CC2)cc(C)c1C#N |
| InChI | InChI=1S/C18H19NO3/c1-10-7-14(8-11(2)15(10)9-19)22-18(16(20)12-3-4-12)17(21)13-5-6-13/h7-8,12-13,18H,3-6H2,1-2H3 |
| InChIKey | GXXCOQPRSCHBFS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|