C18H22N2O2 — CID 71049360
4-[(E)-3-cyclobutyl-1-(dimethylamino)-3-oxoprop-1-en-2-yl]oxy-2,6-dimethylbenzonitrile (PubChem CID 71049360) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[(E)-3-cyclobutyl-1-(dimethylamino)-3-oxoprop-1-en-2-yl]oxy-2,6-dimethylbenzonitrile.
| Compound Name | 4-[(E)-3-cyclobutyl-1-(dimethylamino)-3-oxoprop-1-en-2-yl]oxy-2,6-dimethylbenzonitrile |
|---|---|
| PubChem CID | 71049360 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-[(E)-3-cyclobutyl-1-(dimethylamino)-3-oxoprop-1-en-2-yl]oxy-2,6-dimethylbenzonitrile |
| SMILES | Cc1cc(O/C(=C/N(C)C)C(=O)C2CCC2)cc(C)c1C#N |
| InChI | InChI=1S/C18H22N2O2/c1-12-8-15(9-13(2)16(12)10-19)22-17(11-20(3)4)18(21)14-6-5-7-14/h8-9,11,14H,5-7H2,1-4H3/b17-11+ |
| InChIKey | CMOUGQRGSBIIBF-GZTJUZNOSA-N |
| XLogP | 3.33 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|