C11H10Cl2N2O3 — CID 59710477
5-[(3,4-dichlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59710477) has the molecular formula C11H10Cl2N2O3 and a molecular weight of 289.12 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[(3,4-dichlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59710477 |
| Molecular Formula | C11H10Cl2N2O3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 5-[(3,4-dichlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(COc2ccc(Cl)c(Cl)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C11H10Cl2N2O3/c1-11(9(16)14-10(17)15-11)5-18-6-2-3-7(12)8(13)4-6/h2-4H,5H2,1H3,(H2,14,15,16,17) |
| InChIKey | YSJYVGXUDXKHAX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|