C13H14ClN3O4 — CID 86287514
2-(4-chlorophenoxy)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]acetamide (PubChem CID 86287514) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 86287514 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]acetamide |
| SMILES | C[C@]1(CNC(=O)COc2ccc(Cl)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C13H14ClN3O4/c1-13(11(19)16-12(20)17-13)7-15-10(18)6-21-9-4-2-8(14)3-5-9/h2-5H,6-7H2,1H3,(H,15,18)(H2,16,17,19,20)/t13-/m1/s1 |
| InChIKey | LNIRXDCIYOBRPL-CYBMUJFWSA-N |
| XLogP | 0.43 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|