C5H8N2O4S — CID 59710535
(5R)-5-(methylsulfonylmethyl)imidazolidine-2,4-dione (PubChem CID 59710535) has the molecular formula C5H8N2O4S and a molecular weight of 192.20 g/mol. Its IUPAC name is (5R)-5-(methylsulfonylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(methylsulfonylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59710535 |
| Molecular Formula | C5H8N2O4S |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (5R)-5-(methylsulfonylmethyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)C[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O4S/c1-12(10,11)2-3-4(8)7-5(9)6-3/h3H,2H2,1H3,(H2,6,7,8,9)/t3-/m0/s1 |
| InChIKey | SVENCWCBHOXCHT-VKHMYHEASA-N |
| XLogP | -1.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|