C13H27FSi2 — CID 597120
(5,5-dimethyl-1-trimethylsilylcyclohex-2-en-1-yl)-fluoro-dimethylsilane (PubChem CID 597120) has the molecular formula C13H27FSi2 and a molecular weight of 258.53 g/mol. Its IUPAC name is (5,5-dimethyl-1-trimethylsilylcyclohex-2-en-1-yl)-fluoro-dimethylsilane.
| Compound Name | (5,5-dimethyl-1-trimethylsilylcyclohex-2-en-1-yl)-fluoro-dimethylsilane |
|---|---|
| PubChem CID | 597120 |
| Molecular Formula | C13H27FSi2 |
| Molecular Weight | 258.53 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (5,5-dimethyl-1-trimethylsilylcyclohex-2-en-1-yl)-fluoro-dimethylsilane |
| SMILES | CC1(C)CC=CC([Si](C)(C)C)([Si](C)(C)F)C1 |
| InChI | InChI=1S/C13H27FSi2/c1-12(2)9-8-10-13(11-12,15(3,4)5)16(6,7)14/h8,10H,9,11H2,1-7H3 |
| InChIKey | GWPJORICKAOHCD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|