C11H18N2O2 — CID 59712725
6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]pyridin-2-one (PubChem CID 59712725) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]pyridin-2-one.
| Compound Name | 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]pyridin-2-one |
|---|---|
| PubChem CID | 59712725 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]pyridin-2-one |
| SMILES | CNCCCn1c(O)c(C)c(C)cc1=O |
| InChI | InChI=1S/C11H18N2O2/c1-8-7-10(14)13(6-4-5-12-3)11(15)9(8)2/h7,12,15H,4-6H2,1-3H3 |
| InChIKey | WZHWHRHLBVOMMR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|