C20H24FNO4 — CID 59712868
6-O-ethenyl 2-O-ethyl (1R,2S,4R,5R,6R)-4-fluoro-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 59712868) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-O-ethenyl 2-O-ethyl (1R,2S,4R,5R,6R)-4-fluoro-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | 6-O-ethenyl 2-O-ethyl (1R,2S,4R,5R,6R)-4-fluoro-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 59712868 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 6-O-ethenyl 2-O-ethyl (1R,2S,4R,5R,6R)-4-fluoro-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | C=COC(=O)[C@H]1[C@H]2[C@@H]1[C@](N[C@H](C)c1ccccc1)(C(=O)OCC)C[C@H]2F |
| InChI | InChI=1S/C20H24FNO4/c1-4-25-18(23)16-15-14(21)11-20(17(15)16,19(24)26-5-2)22-12(3)13-9-7-6-8-10-13/h4,6-10,12,14-17,22H,1,5,11H2,2-3H3/t12-,14-,15+,16+,17+,20+/m1/s1 |
| InChIKey | NVTVDSMQHTYTFD-ZJRBYUDRSA-N |
| XLogP | 2.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|