C33H39N3O2 — CID 59715129
N-[2-[4-[[2-(1-adamantyl)-2-oxoethyl]amino]phenyl]-1H-indol-6-yl]cyclohexanecarboxamide (PubChem CID 59715129) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is N-[2-[4-[[2-(1-adamantyl)-2-oxoethyl]amino]phenyl]-1H-indol-6-yl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-[[2-(1-adamantyl)-2-oxoethyl]amino]phenyl]-1H-indol-6-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 59715129 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | N-[2-[4-[[2-(1-adamantyl)-2-oxoethyl]amino]phenyl]-1H-indol-6-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc2cc(-c3ccc(NCC(=O)C45CC6CC(CC(C6)C4)C5)cc3)[nH]c2c1)C1CCCCC1 |
| InChI | InChI=1S/C33H39N3O2/c37-31(33-17-21-12-22(18-33)14-23(13-21)19-33)20-34-27-9-6-24(7-10-27)29-15-26-8-11-28(16-30(26)36-29)35-32(38)25-4-2-1-3-5-25/h6-11,15-16,21-23,25,34,36H,1-5,12-14,17-20H2,(H,35,38) |
| InChIKey | XGQFUZKRHZKYQS-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |