C32H37N3O2 — CID 59715101
N-(2-adamantyl)-2-[4-(cyclohexanecarbonylamino)phenyl]-1H-indole-6-carboxamide (PubChem CID 59715101) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-(2-adamantyl)-2-[4-(cyclohexanecarbonylamino)phenyl]-1H-indole-6-carboxamide.
| Compound Name | N-(2-adamantyl)-2-[4-(cyclohexanecarbonylamino)phenyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 59715101 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-(2-adamantyl)-2-[4-(cyclohexanecarbonylamino)phenyl]-1H-indole-6-carboxamide |
| SMILES | O=C(NC1C2CC3CC(C2)CC1C3)c1ccc2cc(-c3ccc(NC(=O)C4CCCCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C32H37N3O2/c36-31(22-4-2-1-3-5-22)33-27-10-8-21(9-11-27)28-17-23-6-7-24(18-29(23)34-28)32(37)35-30-25-13-19-12-20(15-25)16-26(30)14-19/h6-11,17-20,22,25-26,30,34H,1-5,12-16H2,(H,33,36)(H,35,37) |
| InChIKey | GKQSQWNBPBMGPV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |