C14H11F8N3O3 — CID 59718706
2,2,2-trifluoroethyl (3S)-3-amino-7,8-difluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepine-1-carboxylate (PubChem CID 59718706) has the molecular formula C14H11F8N3O3 and a molecular weight of 421.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (3S)-3-amino-7,8-difluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (3S)-3-amino-7,8-difluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepine-1-carboxylate |
|---|---|
| PubChem CID | 59718706 |
| Molecular Formula | C14H11F8N3O3 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2,2,2-trifluoroethyl (3S)-3-amino-7,8-difluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepine-1-carboxylate |
| SMILES | N[C@H]1CN(C(=O)OCC(F)(F)F)c2cc(F)c(F)cc2N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C14H11F8N3O3/c15-6-1-9-10(2-7(6)16)25(4-13(17,18)19)11(26)8(23)3-24(9)12(27)28-5-14(20,21)22/h1-2,8H,3-5,23H2/t8-/m0/s1 |
| InChIKey | FUCYSYCOCKXAQQ-QMMMGPOBSA-N |
| XLogP | 2.71 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |