C7H7F3N2O2 — CID 165344738
6-amino-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 165344738) has the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. Its IUPAC name is 6-amino-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 6-amino-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 165344738 |
| Molecular Formula | C7H7F3N2O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-amino-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | NC1C2C(=O)N(CC(F)(F)F)C(=O)C12 |
| InChI | InChI=1S/C7H7F3N2O2/c8-7(9,10)1-12-5(13)2-3(4(2)11)6(12)14/h2-4H,1,11H2 |
| InChIKey | ORFUUJSYWMDVHO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|