C23H28N2O18P2-2 — CID 59721036
[(3R,4S,5R,6R)-6-[(4-acetylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl] [[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate (PubChem CID 59721036) has the molecular formula C23H28N2O18P2-2 and a molecular weight of 682.42 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[(4-acetylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl] [[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate.
| Compound Name | [(3R,4S,5R,6R)-6-[(4-acetylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl] [[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 59721036 |
| Molecular Formula | C23H28N2O18P2-2 |
| Molecular Weight | 682.42 g/mol |
| Exact Mass | 682.08 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[(4-acetylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl] [[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate |
| SMILES | CC(=O)c1ccc(OC[C@H]2OC(OP(=O)([O-])OP(=O)([O-])OC[C@H]3O[C@@H](n4ccc(=O)[nH]c4=O)C(O)[C@H]3O)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H30N2O18P2/c1-10(26)11-2-4-12(5-3-11)38-8-13-16(28)18(30)20(32)22(41-13)42-45(36,37)43-44(34,35)39-9-14-17(29)19(31)21(40-14)25-7-6-15(27)24-23(25)33/h2-7,13-14,16-22,28-32H,8-9H2,1H3,(H,34,35)(H,36,37)(H,24,27,33)/p-2/t13-,14-,16+,17+,18+,19?,20-,21-,22?/m1/s1 |
| InChIKey | DAFAUXZMLJFNSK-AGLNPHKKSA-L |
| XLogP | -3.77 |
| TPSA | 308.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.42 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|