C20H32N2O18P2S-2 — CID 90861034
[[(3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,4S,5R)-3,4,5-trihydroxy-6-[2-(2-methoxyethoxy)ethylsulfanylmethyl]oxan-2-yl] phosphate (PubChem CID 90861034) has the molecular formula C20H32N2O18P2S-2 and a molecular weight of 682.49 g/mol. Its IUPAC name is [[(3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,4S,5R)-3,4,5-trihydroxy-6-[2-(2-methoxyethoxy)ethylsulfanylmethyl]oxan-2-yl] phosphate.
| Compound Name | [[(3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,4S,5R)-3,4,5-trihydroxy-6-[2-(2-methoxyethoxy)ethylsulfanylmethyl]oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 90861034 |
| Molecular Formula | C20H32N2O18P2S-2 |
| Molecular Weight | 682.49 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | [[(3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,4S,5R)-3,4,5-trihydroxy-6-[2-(2-methoxyethoxy)ethylsulfanylmethyl]oxan-2-yl] phosphate |
| SMILES | COCCOCCSCC1O[C@H](OP(=O)([O-])OP(=O)([O-])OCC2OC(n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H34N2O18P2S/c1-34-4-5-35-6-7-43-9-11-14(25)15(26)17(28)19(38-11)39-42(32,33)40-41(30,31)36-8-10-13(24)16(27)18(37-10)22-3-2-12(23)21-20(22)29/h2-3,10-11,13-19,24-28H,4-9H2,1H3,(H,30,31)(H,32,33)(H,21,23,29)/p-2/t10?,11?,13-,14+,15+,16-,17?,18?,19-/m1/s1 |
| InChIKey | HMFNIQJKQQYIPJ-LMOIJWHWSA-L |
| XLogP | -4.65 |
| TPSA | 300.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.49 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|