About 4-ethyliminobutanoate
4-ethyliminobutanoate (PubChem CID 59730618) has the molecular formula C6H10NO2-
and a molecular weight of 128.15 g/mol. Its IUPAC name is 4-ethyliminobutanoate.
Molecular Properties
| Compound Name | 4-ethyliminobutanoate |
| PubChem CID | 59730618 |
| Molecular Formula | C6H10NO2- |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 4-ethyliminobutanoate |
| SMILES | CC/N=C/CCC(=O)[O-] |
| InChI | InChI=1S/C6H11NO2/c1-2-7-5-3-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)/p-1/b7-5+ |
| InChIKey | BVKKSWOOJWESNX-FNORWQNLSA-M |
| XLogP | -0.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyliminobutanoate?
The IUPAC name of 4-ethyliminobutanoate (CID 59730618) is 4-ethyliminobutanoate.
What is the SMILES notation for 4-ethyliminobutanoate?
The canonical SMILES for 4-ethyliminobutanoate is CC/N=C/CCC(=O)[O-].
What is the InChIKey of 4-ethyliminobutanoate?
The InChIKey is BVKKSWOOJWESNX-FNORWQNLSA-M. The full InChI is InChI=1S/C6H11NO2/c1-2-7-5-3-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)/p-1/b7-5+.
What are the key properties of 4-ethyliminobutanoate?
4-ethyliminobutanoate has a molecular weight of 128.15 g/mol, XLogP of -0.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyliminobutanoate is sourced from PubChem (CID 59730618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).