C26H36ClN3O6 — CID 59730849
(2S)-N-[(2R,3S)-2-butoxy-5-oxooxolan-3-yl]-1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 59730849) has the molecular formula C26H36ClN3O6 and a molecular weight of 522.04 g/mol. Its IUPAC name is (2S)-N-[(2R,3S)-2-butoxy-5-oxooxolan-3-yl]-1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R,3S)-2-butoxy-5-oxooxolan-3-yl]-1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59730849 |
| Molecular Formula | C26H36ClN3O6 |
| Molecular Weight | 522.04 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2S)-N-[(2R,3S)-2-butoxy-5-oxooxolan-3-yl]-1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCO[C@@H]1OC(=O)C[C@@H]1NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)c1ccccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C26H36ClN3O6/c1-5-6-14-35-25-18(15-20(31)36-25)28-23(33)19-12-9-13-30(19)24(34)21(26(2,3)4)29-22(32)16-10-7-8-11-17(16)27/h7-8,10-11,18-19,21,25H,5-6,9,12-15H2,1-4H3,(H,28,33)(H,29,32)/t18-,19-,21+,25+/m0/s1 |
| InChIKey | URRNGGMDPJBTHJ-MZFHRINRSA-N |
| XLogP | 3.05 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.04 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|