C28H33ClN4O6 — CID 89001995
(2S)-1-[2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[5-oxo-2-(3-phenylpropoxy)oxolan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 89001995) has the molecular formula C28H33ClN4O6 and a molecular weight of 557.05 g/mol. Its IUPAC name is (2S)-1-[2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[5-oxo-2-(3-phenylpropoxy)oxolan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[5-oxo-2-(3-phenylpropoxy)oxolan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89001995 |
| Molecular Formula | C28H33ClN4O6 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (2S)-1-[2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[5-oxo-2-(3-phenylpropoxy)oxolan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(N)c(Cl)c1)C(=O)N1CCC[C@H]1C(=O)NC1CC(=O)OC1OCCCc1ccccc1 |
| InChI | InChI=1S/C28H33ClN4O6/c1-17(31-25(35)19-11-12-21(30)20(29)15-19)27(37)33-13-5-10-23(33)26(36)32-22-16-24(34)39-28(22)38-14-6-9-18-7-3-2-4-8-18/h2-4,7-8,11-12,15,17,22-23,28H,5-6,9-10,13-14,16,30H2,1H3,(H,31,35)(H,32,36)/t17?,22?,23-,28?/m0/s1 |
| InChIKey | HCKPAASPAFQGMT-UCDJZYTESA-N |
| XLogP | 2.44 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|