C27H29F3N4O6 — CID 59043883
(2S)-1-[(2S)-2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 59043883) has the molecular formula C27H29F3N4O6 and a molecular weight of 562.55 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59043883 |
| Molecular Formula | C27H29F3N4O6 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (2S)-1-[(2S)-2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc(N)c(C(F)(F)F)c1)C(=O)N1CCC[C@H]1C(=O)N[C@H]1CC(=O)OC1OCc1ccccc1 |
| InChI | InChI=1S/C27H29F3N4O6/c1-15(32-23(36)17-9-10-19(31)18(12-17)27(28,29)30)25(38)34-11-5-8-21(34)24(37)33-20-13-22(35)40-26(20)39-14-16-6-3-2-4-7-16/h2-4,6-7,9-10,12,15,20-21,26H,5,8,11,13-14,31H2,1H3,(H,32,36)(H,33,37)/t15-,20-,21-,26?/m0/s1 |
| InChIKey | UKBBLPTYAJOBJG-BDOQXTLOSA-N |
| XLogP | 2.37 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|